ChemNet > CAS > 388088-75-3 1,3-dimethyl-1H-thieno[2,3-c]pyrazole-5-carbonyl chloride
388088-75-3 1,3-dimethyl-1H-thieno[2,3-c]pyrazole-5-carbonyl chloride
product Name |
1,3-dimethyl-1H-thieno[2,3-c]pyrazole-5-carbonyl chloride |
Molecular Formula |
C8H7ClN2OS |
Molecular Weight |
214.672 |
InChI |
InChI=1/C8H7ClN2OS/c1-4-5-3-6(7(9)12)13-8(5)11(2)10-4/h3H,1-2H3 |
CAS Registry Number |
388088-75-3 |
Molecular Structure |
|
Density |
1.54g/cm3 |
Melting point |
165℃ |
Boiling point |
336.9°C at 760 mmHg |
Refractive index |
1.707 |
Flash point |
157.5°C |
Vapour Pressur |
0.000109mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|